What´s wrong with the servers?

[Effort]

Has anyone of the S2 employees answered this question yet? Without doubt there must be a lot of players whom are pretty tired of these server issues.
When will this problem get fixed?

[[BOT]Naib]

please provide some infomation as to where the issue resides "server issue" doesn't help resolve or identify where hte issue is unfortunetly

How to provide useful infomation on server lag


Good afternoon so you just experience a game which had some mini-dc or disonnects. unfortunetly that can sometime occur.
The real question is where does it originate?


Your modem/router?
Your ISP?
any number of nodes your infomation traverses?
The Server hoster?
The actual server?



YOU o---o[ISP]o-------o[N1]o------o[N2]o---- ... ---o[N10]o------o[Hoster]o-------o SERVER


S2 can and do contact the providers they rent from BUT they kind of have to be sure where the issue lies


So how can you help?
provide useful infomation such that in combination with other peoples infomation the problem server/s can be shortlisted (if any)




IDENTIFY SERVER IP
This is key. you need to find the IP of the server you were playing on


Once you finish a game in which you were experiencing mini-dc QUIT!
You have to quit to preserve the console.log, from this you can extract the server IP (note there are other ways to get the serverIP [firewall access et al] but this is the most generic)


#1 Finish the game
#2 Quit HoN
#3 Open the console.log
#4 search for: "svr_name"





The two BOLD'ed parts are key
IP=31.204.128.88
Name=EU 179.






#5 Use WinMTR (MTR on linux)
http://winmtr.net/ WinMTR is a traceroute & ping utility in one (pathping does a similar job on windows)
PING on its own is all but USELESS Traceroute, while providing a bit more infomation does not provide a trend BUT a instance.


Doing multiple traceroutes & ping's to each node a map of the connection can be built and this is what WinMTR does. This must run for at least 2min, 5would be good.




NOTE. depending on where said server is located you may find the final node or two does not actually report any infomation, quite a few places will not respond to ECHO request (protection means)
Also Some modern routers give a lower priority to ICMP ECHO packets than to other network traffic. Consequently, the reliability of these routers reported by mtr will be significantly lower than the actual reliability of these routers.




Either way the infomation required is:






IP
NAME
WinMTR Data






The quality of your ISP may have help mitigate the effect or compound it (ie how much buffering they do - you would be surprise how naughty some isp's are)
http://netalyzr.icsi.berkeley.edu/ VERY good link to test your line. VERY good indeed. Well worth running

[Okim]

I got 100/100MBit fiber and otherwise my connection works good. I just did an MTR after playing on a server that had some mini dc, although not as much as I've had in other games before.
Router: ASUS RT-N56U router, also tried with a D-LINK DIR-655 and didn't make a difference.
ISP: teknikbyran.com
12 nodes
Server: EU 106 hosted-by.i3d.net
IP: 188.122.92.84


It looks like there could be a problem with node 7: te-3.1.mal1.se.portlane.net since I got avg ping 160 there and worst 2289

|------------------------------------------------------------------------------------------|
| WinMTR statistics |
| Host - % | Sent | Recv | Best | Avrg | Wrst | Last |
|------------------------------------------------|------|------|------|------|------|------|
| my.router - 0 | 477 | 477 | 0 | 0 | 0 | 0 |
| tb62-102-145-129.cust.teknikbyran.com - 0 | 476 | 476 | 0 | 0 | 2 | 0 |
| vl-2010-akb-dr1.link.teknikbyran.com - 0 | 476 | 476 | 1 | 1 | 19 | 1 |
| vl-3006-akb-cr1.teknikbyran.com - 3 | 437 | 427 | 1 | 8 | 273 | 2 |
|vl-3015-teknikbyran.sto1.se.portlane.net - 2 | 452 | 446 | 2 | 8 | 202 | 13 |
| po-10.sto3.se.portlane.net - 6 | 393 | 372 | 2 | 6 | 282 | 3 |
| te-3-1.mal1.se.portlane.net - 5 | 385 | 368 | 9 | 189 | 2289 | 2289 |
| te-2-1.ams1.nl.portlane.net - 4 | 425 | 412 | 19 | 24 | 218 | 20 |
| 20ge.ams-ix.i3d.net - 4 | 413 | 397 | 20 | 22 | 33 | 21 |
| 40ge-3-1.cr0.smartdc.i3d.net - 3 | 441 | 432 | 21 | 24 | 34 | 22 |
| 20ge-7-1.br0.smartdc.i3d.net - 2 | 445 | 437 | 21 | 22 | 31 | 24 |
| hosted-by.i3d.net - 6 | 397 | 377 | 21 | 22 | 26 | 23 |
|________________________________________________| ______|______|______|______|______|______|
WinMTR v0.92 GPL V2 by Appnor MSP - Fully Managed Hosting & Cloud Provider

I checked the adress up at ripe.net and I guess it would be interesting if more people are experiencing problems going through their nodes.

inetnum: 80.67.4.128 - 80.67.4.255
netname: PORTLANE-LINKNET
descr: Link networks against customers
country: SE
admin-c: PN1967-RIPE
tech-c: PN1967-RIPE
status: ASSIGNED PA
mnt-by: MNT-PORTLANE
source: RIPE #Filtered

Update: I've sent a message to portlane.net detailing the problem with the node and will update this post when I've received anything back.

Update2: Gotten a response from portlane.net. They are aware of the problem and it's going to be resolved this Thursday at 7 PM CEST.

[[TGCH]vici]

This is what i got after playing on EU 136. Been getting mini dcs for 2 days now.

|------------------------------------------------------------------------------------------|

| WinMTR statistics |

| Host - % | Sent | Recv | Best | Avrg | Wrst | Last |

|------------------------------------------------|------|------|------|------|------|------|

| 109-124-145-1.customer.t3.se - 0 | 164 | 164 | 0 | 0 | 1 | 0 |

| 88-83-32-53.customer.t3.se - 0 | 165 | 165 | 1 | 10 | 100 | 36 |

| 46-236-64-86.customer.t3.se - 0 | 165 | 165 | 0 | 2 | 11 | 1 |

| netnod-ix-ge-a-sth-1500.i3d.net - 50 | 57 | 29 | 0 | 32 | 52 | 32 |

| 40ge-3-1.cr0.smartdc.i3d.net - 64 | 47 | 17 | 34 | 34 | 36 | 34 |

| 20ge-7-1.br0.smartdc.i3d.net - 60 | 49 | 20 | 34 | 34 | 35 | 34 |

| hosted-by.i3d.net - 60 | 49 | 20 | 0 | 33 | 34 | 34 |

|________________________________________________| ______|______|______|______|______|______|

[r0b0c0p]

This is what i got after playing on EU 136. Been getting mini dcs for 2 days now.

|------------------------------------------------------------------------------------------|

| WinMTR statistics |

| Host - % | Sent | Recv | Best | Avrg | Wrst | Last |

|------------------------------------------------|------|------|------|------|------|------|

| 109-124-145-1.customer.t3.se - 0 | 164 | 164 | 0 | 0 | 1 | 0 |

| 88-83-32-53.customer.t3.se - 0 | 165 | 165 | 1 | 10 | 100 | 36 |

| 46-236-64-86.customer.t3.se - 0 | 165 | 165 | 0 | 2 | 11 | 1 |

| netnod-ix-ge-a-sth-1500.i3d.net - 50 | 57 | 29 | 0 | 32 | 52 | 32 |

| 40ge-3-1.cr0.smartdc.i3d.net - 64 | 47 | 17 | 34 | 34 | 36 | 34 |

| 20ge-7-1.br0.smartdc.i3d.net - 60 | 49 | 20 | 34 | 34 | 35 | 34 |

| hosted-by.i3d.net - 60 | 49 | 20 | 0 | 33 | 34 | 34 |

|________________________________________________| ______|______|______|______|______|______|

I have the same problem, as you said, going on for 2 days. This makes it almost unplayable, and this proves that this is nothing thats wrong on our side. So, S2, please adress this issue and fix it.

[[BOT]Naib]

The problem is these numbers are pointing to an intermediate node: netnod-ix-ge-a-sth-1500.i3d.net 50% packet loss... This is still 3 hops away from the actual server so it isn't actually the server it is the net in general (see my sig for present state of the global network).

However, that node and subsequent nodes do seem to be part of i3d so while s2 maybe renting from i3d hosting service (educated guess) they may be able to ping i3d to look at their general routing.

more numbers are required. Quoting someone say "I have a similar problem" doesn't help collect info specific to a routing issue

[stormguards]

*bump* same problem.... S2 adress plz...

[[KFB]Roiddarn]

EU 165
188.122.92.102

|------------------------------------------------------------------------------------------|
| WinMTR statistics |
| Host - % | Sent | Recv | Best | Avrg | Wrst | Last |
|------------------------------------------------|------|------|------|------|------|------|
|ua-213-114-200-1.cust.bredbandsbolaget.se - 0 | 277 | 277 | 0 | 2 | 223 | 0 |
| ti3019a210-pc4.ti.telenor.net - 1 | 273 | 272 | 1 | 2 | 196 | 1 |
| ti3002d400-xe3-3-0.ti.telenor.net - 1 | 273 | 272 | 1 | 3 | 46 | 1 |
| ti3002c310-ae13-0.ti.telenor.net - 0 | 277 | 277 | 2 | 6 | 49 | 2 |
| ti3001b300-ae1-0.ti.telenor.net - 1 | 271 | 269 | 2 | 4 | 58 | 21 |
| netnod-ix-ge-b-sth-1500.i3d.net - 0 | 277 | 277 | 31 | 32 | 51 | 31 |
| 10ge-2-3.fr0.fra.i3d.net - 0 | 277 | 277 | 31 | 31 | 42 | 31 |
| 20ge-7-1.br0.smartdc.i3d.net - 0 | 277 | 277 | 31 | 31 | 38 | 32 |
| hosted-by.i3d.net - 0 | 277 | 277 | 31 | 31 | 31 | 31 |
|________________________________________________| ______|______|______|______|______|______|
WinMTR v0.92 GPL V2 by Appnor MSP - Fully Managed Hosting & Cloud Provider


This problem started a few days ago, I have had absolutely no problems before then, and the game just before this one was fine.. This particular server was horrible, 1-2 sec delay every ~30 secs.

[ErzaScaIet]

|------------------------------------------------------------------------------------------|
| WinMTR statistics |
| Host - % | Sent | Recv | Best | Avrg | Wrst | Last |
|------------------------------------------------|------|------|------|------|------|------|
| 10.254.0.1 - 0 | 21 | 21 | 7 | 15 | 65 | 7 |
| ge2-5.lt3-er1.mik.mpynet.fi - 0 | 21 | 21 | 7 | 16 | 67 | 10 |
| te1-1.lt3-er2.mik.mpynet.fi - 0 | 21 | 21 | 7 | 16 | 65 | 9 |
| te1-3-3.lt1-er2.mik.mpynet.fi - 0 | 21 | 21 | 6 | 15 | 65 | 7 |
| te2-1-3.lt1-br1.mik.mpynet.fi - 0 | 21 | 21 | 7 | 27 | 186 | 9 |
| 87.236.154.86 - 0 | 21 | 21 | 10 | 22 | 69 | 12 |
| 87.236.158.5 - 0 | 21 | 21 | 10 | 37 | 224 | 14 |
| te4-2.cr9.mt.ax.as3238.net - 0 | 21 | 21 | 18 | 30 | 107 | 21 |
| te4-2.cr3.kn1.sth.se.as3238.net - 0 | 21 | 21 | 18 | 38 | 154 | 18 |
| No response from host - 100 | 4 | 0 | 0 | 0 | 0 | 0 |
| 40ge-3-1.cr0.smartdc.i3d.net - 6 | 17 | 16 | 48 | 60 | 107 | 48 |
| 20ge-7-1.br0.smartdc.i3d.net - 6 | 17 | 16 | 47 | 57 | 106 | 52 |
| hosted-by.i3d.net - 0 | 21 | 21 | 49 | 57 | 107 | 49 |
|________________________________________________| ______|______|______|______|______|______|
WinMTR v0.92 GPL V2 by Appnor MSP - Fully Managed Hosting & Cloud Provider

Here is what happened when i join server EU 218

http://n1.netalyzr.icsi.berkeley.edu...3-9023#latency
And this is the results of my connection, it said:

• Certain TCP protocols are blocked in outbound traffic
• The measured packet loss was somewhat high
• Network packet buffering may be excessive
• Some DNS resolvers appear to be down

Any idea how to fix this?

[DerpBringer]

EU 5 has horrible lag.

[ErzaScaIet]

Somehow i just played on USE server and i doesn't feel the lag, could only be with EU then?!

[Falling]

I just played a game on EU servers and I had around 70ms, but 2sec delay and saw the DC icon popp up several times during the game, it was completely unplayable. I guess it's related to this?

Got 40/40 mbps net on speedtest.net and the berkley test gave me nothing but OK's (and high latency due to the server being in the US and me in Norway), so I should have no problems at all. So there's deffo something going on somewhere

[ErzaScaIet]

However, that node and subsequent nodes do seem to be part of i3d so while s2 maybe renting from i3d hosting service (educated guess) they may be able to ping i3d to look at their general routing.

more numbers are required. Quoting someone say "I have a similar problem" doesn't help collect info specific to a routing issue

Guys please read this before posting, this is the least you could do to help solve your problem

[BaNaNaBoX]

Had to redo my post so here is the shorter version: I've had mini delays of 1-2sec (when you do a move until your hero responds) in EU servers since the latest patch. Please fix it.

[[Bajs]Ekonomen]

Cl: ^csvr_name^*: ^gEU 89
Cl: ^csvr_ip^*: ^g213.163.73.229
|------------------------------------------------------------------------------------------|
| WinMTR statistics |
| Host - % | Sent | Recv | Best | Avrg | Wrst | Last |
|------------------------------------------------|------|------|------|------|------|------|
| Kis-DOC-3-Bu50.comhem.se - 0 | 121 | 121 | 2 | 9 | 27 | 8 |
| nap-bb-r-01-to-kis-ubr-01-2.comhem.se - 8 | 92 | 85 | 0 | 11 | 44 | 19 |
| 83.255.253.0 - 37 | 49 | 31 | 0 | 14 | 28 | 23 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
|________________________________________________| ______|______|______|______|______|______|
WinMTR v0.92 GPL V2 by Appnor MSP - Fully Managed Hosting & Cloud Provider

Does this mean I will have to go through 30 nodes to get to the gaming server!?

[[BOT]Naib]

Cl: ^csvr_name^*: ^gEU 89
Cl: ^csvr_ip^*: ^g213.163.73.229
|------------------------------------------------------------------------------------------|
| WinMTR statistics |
| Host - % | Sent | Recv | Best | Avrg | Wrst | Last |
|------------------------------------------------|------|------|------|------|------|------|
| Kis-DOC-3-Bu50.comhem.se - 0 | 121 | 121 | 2 | 9 | 27 | 8 |
| nap-bb-r-01-to-kis-ubr-01-2.comhem.se - 8 | 92 | 85 | 0 | 11 | 44 | 19 |
| 83.255.253.0 - 37 | 49 | 31 | 0 | 14 | 28 | 23 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
| No response from host - 100 | 24 | 0 | 0 | 0 | 0 | 0 |
|________________________________________________| ______|______|______|______|______|______|
WinMTR v0.92 GPL V2 by Appnor MSP - Fully Managed Hosting & Cloud Provider

Does this mean I will have to go through 30 nodes to get to the gaming server!?

it means your isp has screwed up

[FragoliTE]

Had to redo my post so here is the shorter version: I've had mini delays of 1-2sec (when you do a move until your hero responds) in EU servers since the latest patch. Please fix it.

This, I've had this over 1 week now, everyday, first I thought it was temporarily but since it has stayed with the EXACT same lag, like you said, commands come a long time after (disconnect icon appears for a short time).

EU

[[BOT]Naib]

ok since people are not actually providing information may I remind you this is not techsupport.
A supposition was made claiming the servers were having issues, no where near enough information has been provided (yet lots of post) to assist in this, thus this is a tech issue


You should try and contact the helpdesk located here http://helpdesk.s2games.com for this.
They will know exactly what to do and how to fix your problem.